C17H31N3O4S — CID 97440857
[(3aR,8aR)-1-ethyl-6-ethylsulfonyl-3,4,5,7,8,8a-hexahydro-2H-pyrrolo[2,3-d]azepin-3a-yl]-morpholin-4-ylmethanone (PubChem CID 97440857) has the molecular formula C17H31N3O4S and a molecular weight of 373.52 g/mol. Its IUPAC name is [(3aR,8aR)-1-ethyl-6-ethylsulfonyl-3,4,5,7,8,8a-hexahydro-2H-pyrrolo[2,3-d]azepin-3a-yl]-morpholin-4-ylmethanone.
| Compound Name | [(3aR,8aR)-1-ethyl-6-ethylsulfonyl-3,4,5,7,8,8a-hexahydro-2H-pyrrolo[2,3-d]azepin-3a-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 97440857 |
| Molecular Formula | C17H31N3O4S |
| Molecular Weight | 373.52 g/mol |
| Exact Mass | 373.20 |
| IUPAC Name | [(3aR,8aR)-1-ethyl-6-ethylsulfonyl-3,4,5,7,8,8a-hexahydro-2H-pyrrolo[2,3-d]azepin-3a-yl]-morpholin-4-ylmethanone |
| SMILES | CCN1CC[C@@]2(C(=O)N3CCOCC3)CCN(S(=O)(=O)CC)CC[C@@H]12 |
| InChI | InChI=1S/C17H31N3O4S/c1-3-18-9-6-17(16(21)19-11-13-24-14-12-19)7-10-20(8-5-15(17)18)25(22,23)4-2/h15H,3-14H2,1-2H3/t15-,17-/m1/s1 |
| InChIKey | DKIQTTFHTJLBPN-NVXWUHKLSA-N |
| XLogP | 0.37 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.52 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |