C19H23ClN4O2S — CID 97442575
6-N-(3-chlorophenyl)-2-N,2-N-diethyl-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepine-2,6-dicarboxamide (PubChem CID 97442575) has the molecular formula C19H23ClN4O2S and a molecular weight of 406.94 g/mol. Its IUPAC name is 6-N-(3-chlorophenyl)-2-N,2-N-diethyl-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepine-2,6-dicarboxamide.
| Compound Name | 6-N-(3-chlorophenyl)-2-N,2-N-diethyl-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepine-2,6-dicarboxamide |
|---|---|
| PubChem CID | 97442575 |
| Molecular Formula | C19H23ClN4O2S |
| Molecular Weight | 406.94 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | 6-N-(3-chlorophenyl)-2-N,2-N-diethyl-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepine-2,6-dicarboxamide |
| SMILES | CCN(CC)C(=O)c1nc2c(s1)CCN(C(=O)Nc1cccc(Cl)c1)CC2 |
| InChI | InChI=1S/C19H23ClN4O2S/c1-3-23(4-2)18(25)17-22-15-8-10-24(11-9-16(15)27-17)19(26)21-14-7-5-6-13(20)12-14/h5-7,12H,3-4,8-11H2,1-2H3,(H,21,26) |
| InChIKey | PCRLCYJVCLEQHZ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.94 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |