C17H22ClN3O2 — CID 97444442
(2R)-N-[3-chloro-4-(propan-2-ylcarbamoyl)phenyl]-2-ethyl-2,5-dihydropyrrole-1-carboxamide (PubChem CID 97444442) has the molecular formula C17H22ClN3O2 and a molecular weight of 335.84 g/mol. Its IUPAC name is (2R)-N-[3-chloro-4-(propan-2-ylcarbamoyl)phenyl]-2-ethyl-2,5-dihydropyrrole-1-carboxamide.
| Compound Name | (2R)-N-[3-chloro-4-(propan-2-ylcarbamoyl)phenyl]-2-ethyl-2,5-dihydropyrrole-1-carboxamide |
|---|---|
| PubChem CID | 97444442 |
| Molecular Formula | C17H22ClN3O2 |
| Molecular Weight | 335.84 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | (2R)-N-[3-chloro-4-(propan-2-ylcarbamoyl)phenyl]-2-ethyl-2,5-dihydropyrrole-1-carboxamide |
| SMILES | CC[C@@H]1C=CCN1C(=O)Nc1ccc(C(=O)NC(C)C)c(Cl)c1 |
| InChI | InChI=1S/C17H22ClN3O2/c1-4-13-6-5-9-21(13)17(23)20-12-7-8-14(15(18)10-12)16(22)19-11(2)3/h5-8,10-11,13H,4,9H2,1-3H3,(H,19,22)(H,20,23)/t13-/m1/s1 |
| InChIKey | FYZAEYYYEMBVQJ-CYBMUJFWSA-N |
| XLogP | 3.66 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.84 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|