C26H25N3O — CID 97449030
N-(4-anilinophenyl)spiro[indene-3,4'-piperidine]-1-carboxamide (PubChem CID 97449030) has the molecular formula C26H25N3O and a molecular weight of 395.51 g/mol. Its IUPAC name is N-(4-anilinophenyl)spiro[indene-3,4'-piperidine]-1-carboxamide.
| Compound Name | N-(4-anilinophenyl)spiro[indene-3,4'-piperidine]-1-carboxamide |
|---|---|
| PubChem CID | 97449030 |
| Molecular Formula | C26H25N3O |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | N-(4-anilinophenyl)spiro[indene-3,4'-piperidine]-1-carboxamide |
| SMILES | O=C(Nc1ccc(Nc2ccccc2)cc1)C1=CC2(CCNCC2)c2ccccc21 |
| InChI | InChI=1S/C26H25N3O/c30-25(29-21-12-10-20(11-13-21)28-19-6-2-1-3-7-19)23-18-26(14-16-27-17-15-26)24-9-5-4-8-22(23)24/h1-13,18,27-28H,14-17H2,(H,29,30) |
| InChIKey | WGIUBUPNBWNFDG-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |