C18H25NO — CID 91052869
ethane;1-spiro[3H-naphthalene-4,4'-piperidine]-1-ylethanone (PubChem CID 91052869) has the molecular formula C18H25NO and a molecular weight of 271.40 g/mol. Its IUPAC name is ethane;1-spiro[3H-naphthalene-4,4'-piperidine]-1-ylethanone.
| Compound Name | ethane;1-spiro[3H-naphthalene-4,4'-piperidine]-1-ylethanone |
|---|---|
| PubChem CID | 91052869 |
| Molecular Formula | C18H25NO |
| Molecular Weight | 271.40 g/mol |
| Exact Mass | 271.19 |
| IUPAC Name | ethane;1-spiro[3H-naphthalene-4,4'-piperidine]-1-ylethanone |
| SMILES | CC.CC(=O)C1=CCC2(CCNCC2)c2ccccc21 |
| InChI | InChI=1S/C16H19NO.C2H6/c1-12(18)13-6-7-16(8-10-17-11-9-16)15-5-3-2-4-14(13)15;1-2/h2-6,17H,7-11H2,1H3;1-2H3 |
| InChIKey | LVGSNOQRAXHVCT-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.40 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |