C20H27NO — CID 143604165
(4R)-4-methyl-1-spiro[indene-3,4'-piperidine]-1-ylhexan-1-one (PubChem CID 143604165) has the molecular formula C20H27NO and a molecular weight of 297.44 g/mol. Its IUPAC name is (4R)-4-methyl-1-spiro[indene-3,4'-piperidine]-1-ylhexan-1-one.
| Compound Name | (4R)-4-methyl-1-spiro[indene-3,4'-piperidine]-1-ylhexan-1-one |
|---|---|
| PubChem CID | 143604165 |
| Molecular Formula | C20H27NO |
| Molecular Weight | 297.44 g/mol |
| Exact Mass | 297.21 |
| IUPAC Name | (4R)-4-methyl-1-spiro[indene-3,4'-piperidine]-1-ylhexan-1-one |
| SMILES | CC[C@@H](C)CCC(=O)C1=CC2(CCNCC2)c2ccccc21 |
| InChI | InChI=1S/C20H27NO/c1-3-15(2)8-9-19(22)17-14-20(10-12-21-13-11-20)18-7-5-4-6-16(17)18/h4-7,14-15,21H,3,8-13H2,1-2H3/t15-/m1/s1 |
| InChIKey | VREZXPDEDPQXGB-OAHLLOKOSA-N |
| XLogP | 4.10 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.44 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |