C17H30N2O4 — CID 97461200
2-[[(3aS,5R,7aS)-1-(2-methoxyethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-5-yl]methoxy]-1-pyrrolidin-1-ylethanone (PubChem CID 97461200) has the molecular formula C17H30N2O4 and a molecular weight of 326.44 g/mol. Its IUPAC name is 2-[[(3aS,5R,7aS)-1-(2-methoxyethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-5-yl]methoxy]-1-pyrrolidin-1-ylethanone.
| Compound Name | 2-[[(3aS,5R,7aS)-1-(2-methoxyethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-5-yl]methoxy]-1-pyrrolidin-1-ylethanone |
|---|---|
| PubChem CID | 97461200 |
| Molecular Formula | C17H30N2O4 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.22 |
| IUPAC Name | 2-[[(3aS,5R,7aS)-1-(2-methoxyethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-5-yl]methoxy]-1-pyrrolidin-1-ylethanone |
| SMILES | COCCN1CC[C@@H]2O[C@@H](COCC(=O)N3CCCC3)CC[C@@H]21 |
| InChI | InChI=1S/C17H30N2O4/c1-21-11-10-18-9-6-16-15(18)5-4-14(23-16)12-22-13-17(20)19-7-2-3-8-19/h14-16H,2-13H2,1H3/t14-,15+,16+/m1/s1 |
| InChIKey | AAANHZDVWLOOQL-PMPSAXMXSA-N |
| XLogP | 0.89 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |