C18H30N2O4 — CID 97461203
2-[[(3aS,5R,7aS)-1-[(3S)-oxolan-3-yl]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-5-yl]methoxy]-1-pyrrolidin-1-ylethanone (PubChem CID 97461203) has the molecular formula C18H30N2O4 and a molecular weight of 338.45 g/mol. Its IUPAC name is 2-[[(3aS,5R,7aS)-1-[(3S)-oxolan-3-yl]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-5-yl]methoxy]-1-pyrrolidin-1-ylethanone.
| Compound Name | 2-[[(3aS,5R,7aS)-1-[(3S)-oxolan-3-yl]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-5-yl]methoxy]-1-pyrrolidin-1-ylethanone |
|---|---|
| PubChem CID | 97461203 |
| Molecular Formula | C18H30N2O4 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.22 |
| IUPAC Name | 2-[[(3aS,5R,7aS)-1-[(3S)-oxolan-3-yl]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-5-yl]methoxy]-1-pyrrolidin-1-ylethanone |
| SMILES | O=C(COC[C@H]1CC[C@H]2[C@H](CCN2[C@H]2CCOC2)O1)N1CCCC1 |
| InChI | InChI=1S/C18H30N2O4/c21-18(19-7-1-2-8-19)13-23-12-15-3-4-16-17(24-15)5-9-20(16)14-6-10-22-11-14/h14-17H,1-13H2/t14-,15+,16-,17-/m0/s1 |
| InChIKey | GHXNCEWHSDOZQG-YVSFHVDLSA-N |
| XLogP | 1.04 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |