C14H18FN3O2 — CID 97461513
(3S,3aS,7aR)-1-(5-fluoropyrimidin-2-yl)-3-prop-2-enoxy-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole (PubChem CID 97461513) has the molecular formula C14H18FN3O2 and a molecular weight of 279.31 g/mol. Its IUPAC name is (3S,3aS,7aR)-1-(5-fluoropyrimidin-2-yl)-3-prop-2-enoxy-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole.
| Compound Name | (3S,3aS,7aR)-1-(5-fluoropyrimidin-2-yl)-3-prop-2-enoxy-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole |
|---|---|
| PubChem CID | 97461513 |
| Molecular Formula | C14H18FN3O2 |
| Molecular Weight | 279.31 g/mol |
| Exact Mass | 279.14 |
| IUPAC Name | (3S,3aS,7aR)-1-(5-fluoropyrimidin-2-yl)-3-prop-2-enoxy-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole |
| SMILES | C=CCO[C@H]1CN(c2ncc(F)cn2)[C@@H]2CCCO[C@H]12 |
| InChI | InChI=1S/C14H18FN3O2/c1-2-5-19-12-9-18(11-4-3-6-20-13(11)12)14-16-7-10(15)8-17-14/h2,7-8,11-13H,1,3-6,9H2/t11-,12+,13+/m1/s1 |
| InChIKey | NHHZNADWHWLKGU-AGIUHOORSA-N |
| XLogP | 1.55 |
| TPSA | 47.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.31 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|