C18H18N4O3 — CID 97462604
(Z)-N-[(3S)-2,5-dioxopyrrolidin-3-yl]-N-ethyl-3-(1-phenylpyrazol-4-yl)prop-2-enamide (PubChem CID 97462604) has the molecular formula C18H18N4O3 and a molecular weight of 338.37 g/mol. Its IUPAC name is (Z)-N-[(3S)-2,5-dioxopyrrolidin-3-yl]-N-ethyl-3-(1-phenylpyrazol-4-yl)prop-2-enamide.
| Compound Name | (Z)-N-[(3S)-2,5-dioxopyrrolidin-3-yl]-N-ethyl-3-(1-phenylpyrazol-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 97462604 |
| Molecular Formula | C18H18N4O3 |
| Molecular Weight | 338.37 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | (Z)-N-[(3S)-2,5-dioxopyrrolidin-3-yl]-N-ethyl-3-(1-phenylpyrazol-4-yl)prop-2-enamide |
| SMILES | CCN(C(=O)/C=C\c1cnn(-c2ccccc2)c1)[C@H]1CC(=O)NC1=O |
| InChI | InChI=1S/C18H18N4O3/c1-2-21(15-10-16(23)20-18(15)25)17(24)9-8-13-11-19-22(12-13)14-6-4-3-5-7-14/h3-9,11-12,15H,2,10H2,1H3,(H,20,23,25)/b9-8-/t15-/m0/s1 |
| InChIKey | ZLGWSOBFIKVIHW-CDNLZTBQSA-N |
| XLogP | 1.15 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.37 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|