C19H24N4O3 — CID 97475523
1-[(1S,3aR,7aR)-1-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-5-yl]-2-phenoxyethanone (PubChem CID 97475523) has the molecular formula C19H24N4O3 and a molecular weight of 356.43 g/mol. Its IUPAC name is 1-[(1S,3aR,7aR)-1-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-5-yl]-2-phenoxyethanone.
| Compound Name | 1-[(1S,3aR,7aR)-1-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-5-yl]-2-phenoxyethanone |
|---|---|
| PubChem CID | 97475523 |
| Molecular Formula | C19H24N4O3 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | 1-[(1S,3aR,7aR)-1-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-5-yl]-2-phenoxyethanone |
| SMILES | Cc1nc(C[C@@H]2OC[C@H]3CN(C(=O)COc4ccccc4)CC[C@H]32)n[nH]1 |
| InChI | InChI=1S/C19H24N4O3/c1-13-20-18(22-21-13)9-17-16-7-8-23(10-14(16)11-26-17)19(24)12-25-15-5-3-2-4-6-15/h2-6,14,16-17H,7-12H2,1H3,(H,20,21,22)/t14-,16-,17+/m1/s1 |
| InChIKey | VUZXNQMSQCPXRA-OIISXLGYSA-N |
| XLogP | 1.60 |
| TPSA | 80.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |