C15H25N3O2 — CID 97487044
(3R)-3-(2-methoxyethyl)-8-(1H-pyrazol-5-ylmethyl)-1-oxa-8-azaspiro[4.5]decane (PubChem CID 97487044) has the molecular formula C15H25N3O2 and a molecular weight of 279.38 g/mol. Its IUPAC name is (3R)-3-(2-methoxyethyl)-8-(1H-pyrazol-5-ylmethyl)-1-oxa-8-azaspiro[4.5]decane.
| Compound Name | (3R)-3-(2-methoxyethyl)-8-(1H-pyrazol-5-ylmethyl)-1-oxa-8-azaspiro[4.5]decane |
|---|---|
| PubChem CID | 97487044 |
| Molecular Formula | C15H25N3O2 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.19 |
| IUPAC Name | (3R)-3-(2-methoxyethyl)-8-(1H-pyrazol-5-ylmethyl)-1-oxa-8-azaspiro[4.5]decane |
| SMILES | COCC[C@H]1COC2(CCN(Cc3ccn[nH]3)CC2)C1 |
| InChI | InChI=1S/C15H25N3O2/c1-19-9-3-13-10-15(20-12-13)4-7-18(8-5-15)11-14-2-6-16-17-14/h2,6,13H,3-5,7-12H2,1H3,(H,16,17)/t13-/m1/s1 |
| InChIKey | YJBIDHAIHZUJCI-CYBMUJFWSA-N |
| XLogP | 1.82 |
| TPSA | 50.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |