C21H23N3 — CID 141031204
4,4-diphenyl-1-(1H-pyrazol-5-ylmethyl)piperidine (PubChem CID 141031204) has the molecular formula C21H23N3 and a molecular weight of 317.44 g/mol. Its IUPAC name is 4,4-diphenyl-1-(1H-pyrazol-5-ylmethyl)piperidine.
| Compound Name | 4,4-diphenyl-1-(1H-pyrazol-5-ylmethyl)piperidine |
|---|---|
| PubChem CID | 141031204 |
| Molecular Formula | C21H23N3 |
| Molecular Weight | 317.44 g/mol |
| Exact Mass | 317.19 |
| IUPAC Name | 4,4-diphenyl-1-(1H-pyrazol-5-ylmethyl)piperidine |
| SMILES | c1ccc(C2(c3ccccc3)CCN(Cc3ccn[nH]3)CC2)cc1 |
| InChI | InChI=1S/C21H23N3/c1-3-7-18(8-4-1)21(19-9-5-2-6-10-19)12-15-24(16-13-21)17-20-11-14-22-23-20/h1-11,14H,12-13,15-17H2,(H,22,23) |
| InChIKey | HNAAEBVBTMQNPX-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.44 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |