C12H25N3 — CID 144702602
ethane;4-methyl-1-(1H-pyrazol-5-ylmethyl)piperidine;molecular hydrogen (PubChem CID 144702602) has the molecular formula C12H25N3 and a molecular weight of 211.35 g/mol. Its IUPAC name is ethane;4-methyl-1-(1H-pyrazol-5-ylmethyl)piperidine;molecular hydrogen.
| Compound Name | ethane;4-methyl-1-(1H-pyrazol-5-ylmethyl)piperidine;molecular hydrogen |
|---|---|
| PubChem CID | 144702602 |
| Molecular Formula | C12H25N3 |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.20 |
| IUPAC Name | ethane;4-methyl-1-(1H-pyrazol-5-ylmethyl)piperidine;molecular hydrogen |
| SMILES | CC.CC1CCN(Cc2ccn[nH]2)CC1.[H][H] |
| InChI | InChI=1S/C10H17N3.C2H6.H2/c1-9-3-6-13(7-4-9)8-10-2-5-11-12-10;1-2;/h2,5,9H,3-4,6-8H2,1H3,(H,11,12);1-2H3;1H |
| InChIKey | JZQUQFVBLDWLCS-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |