C8H11F2N3 — CID 131101674
5-[(3,3-difluoropyrrolidin-1-yl)methyl]-1H-pyrazole (PubChem CID 131101674) has the molecular formula C8H11F2N3 and a molecular weight of 187.19 g/mol. Its IUPAC name is 5-[(3,3-difluoropyrrolidin-1-yl)methyl]-1H-pyrazole.
| Compound Name | 5-[(3,3-difluoropyrrolidin-1-yl)methyl]-1H-pyrazole |
|---|---|
| PubChem CID | 131101674 |
| Molecular Formula | C8H11F2N3 |
| Molecular Weight | 187.19 g/mol |
| Exact Mass | 187.09 |
| IUPAC Name | 5-[(3,3-difluoropyrrolidin-1-yl)methyl]-1H-pyrazole |
| SMILES | FC1(F)CCN(Cc2ccn[nH]2)C1 |
| InChI | InChI=1S/C8H11F2N3/c9-8(10)2-4-13(6-8)5-7-1-3-11-12-7/h1,3H,2,4-6H2,(H,11,12) |
| InChIKey | ZBTBVDNZQIEZDF-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.19 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |