C21H26N4 — CID 162015011
1-benzyl-4-phenyl-4-(1H-1,2,4-triazol-5-yl)piperidine;methane (PubChem CID 162015011) has the molecular formula C21H26N4 and a molecular weight of 334.47 g/mol. Its IUPAC name is 1-benzyl-4-phenyl-4-(1H-1,2,4-triazol-5-yl)piperidine;methane.
| Compound Name | 1-benzyl-4-phenyl-4-(1H-1,2,4-triazol-5-yl)piperidine;methane |
|---|---|
| PubChem CID | 162015011 |
| Molecular Formula | C21H26N4 |
| Molecular Weight | 334.47 g/mol |
| Exact Mass | 334.22 |
| IUPAC Name | 1-benzyl-4-phenyl-4-(1H-1,2,4-triazol-5-yl)piperidine;methane |
| SMILES | C.c1ccc(CN2CCC(c3ccccc3)(c3ncn[nH]3)CC2)cc1 |
| InChI | InChI=1S/C20H22N4.CH4/c1-3-7-17(8-4-1)15-24-13-11-20(12-14-24,19-21-16-22-23-19)18-9-5-2-6-10-18;/h1-10,16H,11-15H2,(H,21,22,23);1H4 |
| InChIKey | YTZJLUSGQYYRHA-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.47 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |