C16H23N3OS — CID 97494229
1-prop-2-enyl-8-(1,3-thiazol-2-ylmethylamino)-1-azaspiro[4.5]decan-2-one (PubChem CID 97494229) has the molecular formula C16H23N3OS and a molecular weight of 305.45 g/mol. Its IUPAC name is 1-prop-2-enyl-8-(1,3-thiazol-2-ylmethylamino)-1-azaspiro[4.5]decan-2-one.
| Compound Name | 1-prop-2-enyl-8-(1,3-thiazol-2-ylmethylamino)-1-azaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 97494229 |
| Molecular Formula | C16H23N3OS |
| Molecular Weight | 305.45 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | 1-prop-2-enyl-8-(1,3-thiazol-2-ylmethylamino)-1-azaspiro[4.5]decan-2-one |
| SMILES | C=CCN1C(=O)CCC12CCC(NCc1nccs1)CC2 |
| InChI | InChI=1S/C16H23N3OS/c1-2-10-19-15(20)5-8-16(19)6-3-13(4-7-16)18-12-14-17-9-11-21-14/h2,9,11,13,18H,1,3-8,10,12H2 |
| InChIKey | ZIHYUXQLUVYQCW-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.45 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|