C16H20N2O9 — CID 98008493
1-[(1R)-2-[2-[(2S)-2-(2,5-dioxopyrrol-1-yl)-2-(2-hydroxyethoxy)ethoxy]ethoxy]-1-hydroxyethyl]pyrrole-2,5-dione (PubChem CID 98008493) has the molecular formula C16H20N2O9 and a molecular weight of 384.34 g/mol. Its IUPAC name is 1-[(1R)-2-[2-[(2S)-2-(2,5-dioxopyrrol-1-yl)-2-(2-hydroxyethoxy)ethoxy]ethoxy]-1-hydroxyethyl]pyrrole-2,5-dione.
| Compound Name | 1-[(1R)-2-[2-[(2S)-2-(2,5-dioxopyrrol-1-yl)-2-(2-hydroxyethoxy)ethoxy]ethoxy]-1-hydroxyethyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 98008493 |
| Molecular Formula | C16H20N2O9 |
| Molecular Weight | 384.34 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | 1-[(1R)-2-[2-[(2S)-2-(2,5-dioxopyrrol-1-yl)-2-(2-hydroxyethoxy)ethoxy]ethoxy]-1-hydroxyethyl]pyrrole-2,5-dione |
| SMILES | O=C1C=CC(=O)N1[C@H](O)COCCOC[C@H](OCCO)N1C(=O)C=CC1=O |
| InChI | InChI=1S/C16H20N2O9/c19-5-6-27-16(18-13(22)3-4-14(18)23)10-26-8-7-25-9-15(24)17-11(20)1-2-12(17)21/h1-4,15-16,19,24H,5-10H2/t15-,16+/m1/s1 |
| InChIKey | RFLFYXWXIILHTK-CVEARBPZSA-N |
| XLogP | -2.48 |
| TPSA | 142.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.34 |
| LogP ≤ 5 | -2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|