C10H15NO6 — CID 118368636
1-[(1S)-1-hydroxy-2-[2-(2-hydroxyethoxy)ethoxy]ethyl]pyrrole-2,5-dione (PubChem CID 118368636) has the molecular formula C10H15NO6 and a molecular weight of 245.23 g/mol. Its IUPAC name is 1-[(1S)-1-hydroxy-2-[2-(2-hydroxyethoxy)ethoxy]ethyl]pyrrole-2,5-dione.
| Compound Name | 1-[(1S)-1-hydroxy-2-[2-(2-hydroxyethoxy)ethoxy]ethyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 118368636 |
| Molecular Formula | C10H15NO6 |
| Molecular Weight | 245.23 g/mol |
| Exact Mass | 245.09 |
| IUPAC Name | 1-[(1S)-1-hydroxy-2-[2-(2-hydroxyethoxy)ethoxy]ethyl]pyrrole-2,5-dione |
| SMILES | O=C1C=CC(=O)N1[C@@H](O)COCCOCCO |
| InChI | InChI=1S/C10H15NO6/c12-3-4-16-5-6-17-7-10(15)11-8(13)1-2-9(11)14/h1-2,10,12,15H,3-7H2/t10-/m0/s1 |
| InChIKey | WMARVQFRASXGJV-JTQLQIEISA-N |
| XLogP | -1.74 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.23 |
| LogP ≤ 5 | -1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|