C11H10F6S — CID 98041538
[(3S)-2,2,3,4,4,4-hexafluorobutyl]sulfanylmethylbenzene (PubChem CID 98041538) has the molecular formula C11H10F6S and a molecular weight of 288.26 g/mol. Its IUPAC name is [(3S)-2,2,3,4,4,4-hexafluorobutyl]sulfanylmethylbenzene.
| Compound Name | [(3S)-2,2,3,4,4,4-hexafluorobutyl]sulfanylmethylbenzene |
|---|---|
| PubChem CID | 98041538 |
| Molecular Formula | C11H10F6S |
| Molecular Weight | 288.26 g/mol |
| Exact Mass | 288.04 |
| IUPAC Name | [(3S)-2,2,3,4,4,4-hexafluorobutyl]sulfanylmethylbenzene |
| SMILES | F[C@H](C(F)(F)F)C(F)(F)CSCc1ccccc1 |
| InChI | InChI=1S/C11H10F6S/c12-9(11(15,16)17)10(13,14)7-18-6-8-4-2-1-3-5-8/h1-5,9H,6-7H2/t9-/m0/s1 |
| InChIKey | WDXYKHYNTRDMSZ-VIFPVBQESA-N |
| XLogP | 4.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.26 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |