C15H19N5O2 — CID 98050911
N-[(Z)-1-(4-aminophenyl)ethylideneamino]-3-[(4R)-3-methyl-5-oxo-1,4-dihydropyrazol-4-yl]propanamide (PubChem CID 98050911) has the molecular formula C15H19N5O2 and a molecular weight of 301.35 g/mol. Its IUPAC name is N-[(Z)-1-(4-aminophenyl)ethylideneamino]-3-[(4R)-3-methyl-5-oxo-1,4-dihydropyrazol-4-yl]propanamide.
| Compound Name | N-[(Z)-1-(4-aminophenyl)ethylideneamino]-3-[(4R)-3-methyl-5-oxo-1,4-dihydropyrazol-4-yl]propanamide |
|---|---|
| PubChem CID | 98050911 |
| Molecular Formula | C15H19N5O2 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | N-[(Z)-1-(4-aminophenyl)ethylideneamino]-3-[(4R)-3-methyl-5-oxo-1,4-dihydropyrazol-4-yl]propanamide |
| SMILES | CC1=NNC(=O)[C@@H]1CCC(=O)N/N=C(/C)c1ccc(N)cc1 |
| InChI | InChI=1S/C15H19N5O2/c1-9(11-3-5-12(16)6-4-11)17-19-14(21)8-7-13-10(2)18-20-15(13)22/h3-6,13H,7-8,16H2,1-2H3,(H,19,21)(H,20,22)/b17-9-/t13-/m1/s1 |
| InChIKey | KZLGRWPJXLKWGE-ZLYHGVDXSA-N |
| XLogP | 1.01 |
| TPSA | 108.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_anil(14)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|