C18H22N4O6 — CID 98096939
[2,6-dimethoxy-4-[(E)-[3-[(4R)-3-methyl-5-oxo-1,4-dihydropyrazol-4-yl]propanoylhydrazinylidene]methyl]phenyl] acetate (PubChem CID 98096939) has the molecular formula C18H22N4O6 and a molecular weight of 390.40 g/mol. Its IUPAC name is [2,6-dimethoxy-4-[(E)-[3-[(4R)-3-methyl-5-oxo-1,4-dihydropyrazol-4-yl]propanoylhydrazinylidene]methyl]phenyl] acetate.
| Compound Name | [2,6-dimethoxy-4-[(E)-[3-[(4R)-3-methyl-5-oxo-1,4-dihydropyrazol-4-yl]propanoylhydrazinylidene]methyl]phenyl] acetate |
|---|---|
| PubChem CID | 98096939 |
| Molecular Formula | C18H22N4O6 |
| Molecular Weight | 390.40 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | [2,6-dimethoxy-4-[(E)-[3-[(4R)-3-methyl-5-oxo-1,4-dihydropyrazol-4-yl]propanoylhydrazinylidene]methyl]phenyl] acetate |
| SMILES | COc1cc(/C=N/NC(=O)CC[C@H]2C(=O)NN=C2C)cc(OC)c1OC(C)=O |
| InChI | InChI=1S/C18H22N4O6/c1-10-13(18(25)22-20-10)5-6-16(24)21-19-9-12-7-14(26-3)17(28-11(2)23)15(8-12)27-4/h7-9,13H,5-6H2,1-4H3,(H,21,24)(H,22,25)/b19-9+/t13-/m1/s1 |
| InChIKey | ZEKUDQXTZUQAPI-VDLQQMNMSA-N |
| XLogP | 0.98 |
| TPSA | 127.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.40 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|