C8H11ClO — CID 98072137
(1R,5R)-bicyclo[3.1.1]heptane-6-carbonyl chloride (PubChem CID 98072137) has the molecular formula C8H11ClO and a molecular weight of 158.63 g/mol. Its IUPAC name is (1R,5R)-bicyclo[3.1.1]heptane-6-carbonyl chloride.
| Compound Name | (1R,5R)-bicyclo[3.1.1]heptane-6-carbonyl chloride |
|---|---|
| PubChem CID | 98072137 |
| Molecular Formula | C8H11ClO |
| Molecular Weight | 158.63 g/mol |
| Exact Mass | 158.05 |
| IUPAC Name | (1R,5R)-bicyclo[3.1.1]heptane-6-carbonyl chloride |
| SMILES | O=C(Cl)C1[C@@H]2CCC[C@@H]1C2 |
| InChI | InChI=1S/C8H11ClO/c9-8(10)7-5-2-1-3-6(7)4-5/h5-7H,1-4H2/t5-,6-/m1/s1 |
| InChIKey | MGZUGSZEBRVAPC-PHDIDXHHSA-N |
| XLogP | 2.19 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.63 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|