C14H11NO6 — CID 98076878
(1S,2S,6R,8R)-5-(1,3-benzodioxol-5-yl)-3,9,11-trioxa-4-azatricyclo[6.2.1.02,6]undec-4-en-7-one (PubChem CID 98076878) has the molecular formula C14H11NO6 and a molecular weight of 289.24 g/mol. Its IUPAC name is (1S,2S,6R,8R)-5-(1,3-benzodioxol-5-yl)-3,9,11-trioxa-4-azatricyclo[6.2.1.02,6]undec-4-en-7-one.
| Compound Name | (1S,2S,6R,8R)-5-(1,3-benzodioxol-5-yl)-3,9,11-trioxa-4-azatricyclo[6.2.1.02,6]undec-4-en-7-one |
|---|---|
| PubChem CID | 98076878 |
| Molecular Formula | C14H11NO6 |
| Molecular Weight | 289.24 g/mol |
| Exact Mass | 289.06 |
| IUPAC Name | (1S,2S,6R,8R)-5-(1,3-benzodioxol-5-yl)-3,9,11-trioxa-4-azatricyclo[6.2.1.02,6]undec-4-en-7-one |
| SMILES | O=C1[C@@H]2OC[C@H](O2)[C@H]2ON=C(c3ccc4c(c3)OCO4)[C@@H]12 |
| InChI | InChI=1S/C14H11NO6/c16-12-10-11(6-1-2-7-8(3-6)19-5-18-7)15-21-13(10)9-4-17-14(12)20-9/h1-3,9-10,13-14H,4-5H2/t9-,10-,13+,14+/m0/s1 |
| InChIKey | MLNVNWPJCRTWRD-DUBDDPSESA-N |
| XLogP | 0.46 |
| TPSA | 75.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.24 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |