C27H40O4 — CID 98080945
(1S,2R,5R,6R,9S,10R,12S)-1,5-dimethyl-6-[(2R)-6-methylheptan-2-yl]-11,13-dioxotetracyclo[10.3.1.02,10.05,9]hexadec-14-ene-15-carboxylic acid (PubChem CID 98080945) has the molecular formula C27H40O4 and a molecular weight of 428.61 g/mol. Its IUPAC name is (1S,2R,5R,6R,9S,10R,12S)-1,5-dimethyl-6-[(2R)-6-methylheptan-2-yl]-11,13-dioxotetracyclo[10.3.1.02,10.05,9]hexadec-14-ene-15-carboxylic acid.
| Compound Name | (1S,2R,5R,6R,9S,10R,12S)-1,5-dimethyl-6-[(2R)-6-methylheptan-2-yl]-11,13-dioxotetracyclo[10.3.1.02,10.05,9]hexadec-14-ene-15-carboxylic acid |
|---|---|
| PubChem CID | 98080945 |
| Molecular Formula | C27H40O4 |
| Molecular Weight | 428.61 g/mol |
| Exact Mass | 428.29 |
| IUPAC Name | (1S,2R,5R,6R,9S,10R,12S)-1,5-dimethyl-6-[(2R)-6-methylheptan-2-yl]-11,13-dioxotetracyclo[10.3.1.02,10.05,9]hexadec-14-ene-15-carboxylic acid |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@H]3C(=O)[C@@H]4C[C@](C)(C(C(=O)O)=CC4=O)[C@@H]3CC[C@]12C |
| InChI | InChI=1S/C27H40O4/c1-15(2)7-6-8-16(3)18-9-10-19-23-20(11-12-26(18,19)4)27(5)14-17(24(23)29)22(28)13-21(27)25(30)31/h13,15-20,23H,6-12,14H2,1-5H3,(H,30,31)/t16-,17-,18-,19+,20-,23-,26-,27+/m1/s1 |
| InChIKey | CPOBSJFACVUGSW-LDFPBUPPSA-N |
| XLogP | 5.70 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.61 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|