C26H19BrCl2O4 — CID 98095800
(3E)-3-[[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylidene]-5-(4-methylphenyl)furan-2-one (PubChem CID 98095800) has the molecular formula C26H19BrCl2O4 and a molecular weight of 546.24 g/mol. Its IUPAC name is (3E)-3-[[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylidene]-5-(4-methylphenyl)furan-2-one.
| Compound Name | (3E)-3-[[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylidene]-5-(4-methylphenyl)furan-2-one |
|---|---|
| PubChem CID | 98095800 |
| Molecular Formula | C26H19BrCl2O4 |
| Molecular Weight | 546.24 g/mol |
| Exact Mass | 543.98 |
| IUPAC Name | (3E)-3-[[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylidene]-5-(4-methylphenyl)furan-2-one |
| SMILES | COc1cc(/C=C2\C=C(c3ccc(C)cc3)OC2=O)cc(Br)c1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C26H19BrCl2O4/c1-15-3-5-17(6-4-15)23-12-19(26(30)33-23)9-16-10-21(27)25(24(11-16)31-2)32-14-18-7-8-20(28)13-22(18)29/h3-13H,14H2,1-2H3/b19-9+ |
| InChIKey | PTQIHPUWDWKXIW-DJKKODMXSA-N |
| XLogP | 7.63 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.24 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|