C15H11Cl3N2O2 — CID 98118001
benzyl (2Z)-2-chloro-2-[(3,5-dichlorophenyl)hydrazinylidene]acetate (PubChem CID 98118001) has the molecular formula C15H11Cl3N2O2 and a molecular weight of 357.62 g/mol. Its IUPAC name is benzyl (2Z)-2-chloro-2-[(3,5-dichlorophenyl)hydrazinylidene]acetate.
| Compound Name | benzyl (2Z)-2-chloro-2-[(3,5-dichlorophenyl)hydrazinylidene]acetate |
|---|---|
| PubChem CID | 98118001 |
| Molecular Formula | C15H11Cl3N2O2 |
| Molecular Weight | 357.62 g/mol |
| Exact Mass | 355.99 |
| IUPAC Name | benzyl (2Z)-2-chloro-2-[(3,5-dichlorophenyl)hydrazinylidene]acetate |
| SMILES | O=C(OCc1ccccc1)/C(Cl)=N/Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C15H11Cl3N2O2/c16-11-6-12(17)8-13(7-11)19-20-14(18)15(21)22-9-10-4-2-1-3-5-10/h1-8,19H,9H2/b20-14- |
| InChIKey | CJRYPBMUIXWQTO-ZHZULCJRSA-N |
| XLogP | 4.70 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.62 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|