C32H28ClNO3 — CID 98118939
(1R,2S,6R,7R)-4-(3-chloro-2-methylphenyl)-1,7-diethyl-8,9-diphenyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5,10-trione (PubChem CID 98118939) has the molecular formula C32H28ClNO3 and a molecular weight of 510.03 g/mol. Its IUPAC name is (1R,2S,6R,7R)-4-(3-chloro-2-methylphenyl)-1,7-diethyl-8,9-diphenyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5,10-trione.
| Compound Name | (1R,2S,6R,7R)-4-(3-chloro-2-methylphenyl)-1,7-diethyl-8,9-diphenyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5,10-trione |
|---|---|
| PubChem CID | 98118939 |
| Molecular Formula | C32H28ClNO3 |
| Molecular Weight | 510.03 g/mol |
| Exact Mass | 509.18 |
| IUPAC Name | (1R,2S,6R,7R)-4-(3-chloro-2-methylphenyl)-1,7-diethyl-8,9-diphenyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5,10-trione |
| SMILES | CC[C@]12C(=O)[C@@](CC)(C(c3ccccc3)=C1c1ccccc1)[C@H]1C(=O)N(c3cccc(Cl)c3C)C(=O)[C@H]12 |
| InChI | InChI=1S/C32H28ClNO3/c1-4-31-24(20-13-8-6-9-14-20)25(21-15-10-7-11-16-21)32(5-2,30(31)37)27-26(31)28(35)34(29(27)36)23-18-12-17-22(33)19(23)3/h6-18,26-27H,4-5H2,1-3H3/t26-,27+,31-,32-/m0/s1 |
| InChIKey | JBLHLMLWHQWYLI-PDPQZYGGSA-N |
| XLogP | 6.75 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.03 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|