C32H26N4O7 — CID 98120325
3-benzyl-7-[(2Z)-2-[(2,4-dinitrophenyl)hydrazinylidene]-2-phenylethoxy]-4,8-dimethylchromen-2-one (PubChem CID 98120325) has the molecular formula C32H26N4O7 and a molecular weight of 578.58 g/mol. Its IUPAC name is 3-benzyl-7-[(2Z)-2-[(2,4-dinitrophenyl)hydrazinylidene]-2-phenylethoxy]-4,8-dimethylchromen-2-one.
| Compound Name | 3-benzyl-7-[(2Z)-2-[(2,4-dinitrophenyl)hydrazinylidene]-2-phenylethoxy]-4,8-dimethylchromen-2-one |
|---|---|
| PubChem CID | 98120325 |
| Molecular Formula | C32H26N4O7 |
| Molecular Weight | 578.58 g/mol |
| Exact Mass | 578.18 |
| IUPAC Name | 3-benzyl-7-[(2Z)-2-[(2,4-dinitrophenyl)hydrazinylidene]-2-phenylethoxy]-4,8-dimethylchromen-2-one |
| SMILES | Cc1c(Cc2ccccc2)c(=O)oc2c(C)c(OC/C(=N\Nc3ccc([N+](=O)[O-])cc3[N+](=O)[O-])c3ccccc3)ccc12 |
| InChI | InChI=1S/C32H26N4O7/c1-20-25-14-16-30(21(2)31(25)43-32(37)26(20)17-22-9-5-3-6-10-22)42-19-28(23-11-7-4-8-12-23)34-33-27-15-13-24(35(38)39)18-29(27)36(40)41/h3-16,18,33H,17,19H2,1-2H3/b34-28+ |
| InChIKey | CBVHRZYDEBDIBN-CDSHQWRTSA-N |
| XLogP | 6.71 |
| TPSA | 150.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.58 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|