C16H16INO4 — CID 98125217
benzyl N-[(1S,2R,3S,6S,7R,9S)-2-iodo-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-9-yl]carbamate (PubChem CID 98125217) has the molecular formula C16H16INO4 and a molecular weight of 413.21 g/mol. Its IUPAC name is benzyl N-[(1S,2R,3S,6S,7R,9S)-2-iodo-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-9-yl]carbamate.
| Compound Name | benzyl N-[(1S,2R,3S,6S,7R,9S)-2-iodo-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-9-yl]carbamate |
|---|---|
| PubChem CID | 98125217 |
| Molecular Formula | C16H16INO4 |
| Molecular Weight | 413.21 g/mol |
| Exact Mass | 413.01 |
| IUPAC Name | benzyl N-[(1S,2R,3S,6S,7R,9S)-2-iodo-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-9-yl]carbamate |
| SMILES | O=C(N[C@@H]1[C@@H]2C[C@H]3[C@H](OC(=O)[C@@H]31)[C@@H]2I)OCc1ccccc1 |
| InChI | InChI=1S/C16H16INO4/c17-12-10-6-9-11(15(19)22-14(9)12)13(10)18-16(20)21-7-8-4-2-1-3-5-8/h1-5,9-14H,6-7H2,(H,18,20)/t9-,10-,11+,12-,13-,14+/m1/s1 |
| InChIKey | XBTHKQKFXVBAQV-WNWFYDSVSA-N |
| XLogP | 2.28 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.21 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|