C10H12N4O3 — CID 98128021
2-azido-N-(2,3-dimethoxyphenyl)acetamide (PubChem CID 98128021) has the molecular formula C10H12N4O3 and a molecular weight of 236.23 g/mol. Its IUPAC name is 2-azido-N-(2,3-dimethoxyphenyl)acetamide.
| Compound Name | 2-azido-N-(2,3-dimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 98128021 |
| Molecular Formula | C10H12N4O3 |
| Molecular Weight | 236.23 g/mol |
| Exact Mass | 236.09 |
| IUPAC Name | 2-azido-N-(2,3-dimethoxyphenyl)acetamide |
| SMILES | COc1cccc(NC(=O)CN=[N+]=[N-])c1OC |
| InChI | InChI=1S/C10H12N4O3/c1-16-8-5-3-4-7(10(8)17-2)13-9(15)6-12-14-11/h3-5H,6H2,1-2H3,(H,13,15) |
| InChIKey | BVTAGFHDIKDHOY-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 96.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.23 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|