C30H29ClN2O5 — CID 98131885
4-chloro-N-[(Z)-3-[2-(3,4-dimethoxyphenyl)ethylamino]-1-[(2R)-2-methyl-2H-chromen-3-yl]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 98131885) has the molecular formula C30H29ClN2O5 and a molecular weight of 533.02 g/mol. Its IUPAC name is 4-chloro-N-[(Z)-3-[2-(3,4-dimethoxyphenyl)ethylamino]-1-[(2R)-2-methyl-2H-chromen-3-yl]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | 4-chloro-N-[(Z)-3-[2-(3,4-dimethoxyphenyl)ethylamino]-1-[(2R)-2-methyl-2H-chromen-3-yl]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 98131885 |
| Molecular Formula | C30H29ClN2O5 |
| Molecular Weight | 533.02 g/mol |
| Exact Mass | 532.18 |
| IUPAC Name | 4-chloro-N-[(Z)-3-[2-(3,4-dimethoxyphenyl)ethylamino]-1-[(2R)-2-methyl-2H-chromen-3-yl]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | COc1ccc(CCNC(=O)/C(=C/C2=Cc3ccccc3O[C@@H]2C)NC(=O)c2ccc(Cl)cc2)cc1OC |
| InChI | InChI=1S/C30H29ClN2O5/c1-19-23(17-22-6-4-5-7-26(22)38-19)18-25(33-29(34)21-9-11-24(31)12-10-21)30(35)32-15-14-20-8-13-27(36-2)28(16-20)37-3/h4-13,16-19H,14-15H2,1-3H3,(H,32,35)(H,33,34)/b25-18-/t19-/m1/s1 |
| InChIKey | OYVAGOJFFUUUNQ-ZZMKYJANSA-N |
| XLogP | 5.19 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.02 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|