C14H19NO5 — CID 98133970
ethyl (3R,4S,5R)-4-cyano-7,7-dimethyl-2-oxo-1,8-dioxaspiro[4.5]decane-3-carboxylate (PubChem CID 98133970) has the molecular formula C14H19NO5 and a molecular weight of 281.31 g/mol. Its IUPAC name is ethyl (3R,4S,5R)-4-cyano-7,7-dimethyl-2-oxo-1,8-dioxaspiro[4.5]decane-3-carboxylate.
| Compound Name | ethyl (3R,4S,5R)-4-cyano-7,7-dimethyl-2-oxo-1,8-dioxaspiro[4.5]decane-3-carboxylate |
|---|---|
| PubChem CID | 98133970 |
| Molecular Formula | C14H19NO5 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | ethyl (3R,4S,5R)-4-cyano-7,7-dimethyl-2-oxo-1,8-dioxaspiro[4.5]decane-3-carboxylate |
| SMILES | CCOC(=O)[C@@H]1C(=O)O[C@@]2(CCOC(C)(C)C2)[C@@H]1C#N |
| InChI | InChI=1S/C14H19NO5/c1-4-18-11(16)10-9(7-15)14(20-12(10)17)5-6-19-13(2,3)8-14/h9-10H,4-6,8H2,1-3H3/t9-,10-,14-/m1/s1 |
| InChIKey | LHLUYJVQNYEOKY-GPCCPHFNSA-N |
| XLogP | 1.19 |
| TPSA | 85.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|