C5H9NS — CID 98154474
(1S,4R)-2-thia-5-azabicyclo[2.2.1]heptane (PubChem CID 98154474) has the molecular formula C5H9NS and a molecular weight of 115.20 g/mol. Its IUPAC name is (1S,4R)-2-thia-5-azabicyclo[2.2.1]heptane.
| Compound Name | (1S,4R)-2-thia-5-azabicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 98154474 |
| Molecular Formula | C5H9NS |
| Molecular Weight | 115.20 g/mol |
| Exact Mass | 115.05 |
| IUPAC Name | (1S,4R)-2-thia-5-azabicyclo[2.2.1]heptane |
| SMILES | C1S[C@@H]2CN[C@@H]1C2 |
| InChI | InChI=1S/C5H9NS/c1-4-3-7-5(1)2-6-4/h4-6H,1-3H2/t4-,5+/m1/s1 |
| InChIKey | LTQBUWVDIKUNHJ-UHNVWZDZSA-N |
| XLogP | 0.46 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 115.20 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |