C27H35N3O10 — CID 98169612
[(2S,3S,4S,5R,6S)-5-acetamido-3,4-diacetyloxy-6-[(E)-[5-methyl-1-(2-methylpropyl)-2-oxoindol-3-ylidene]amino]oxyoxan-2-yl]methyl acetate (PubChem CID 98169612) has the molecular formula C27H35N3O10 and a molecular weight of 561.59 g/mol. Its IUPAC name is [(2S,3S,4S,5R,6S)-5-acetamido-3,4-diacetyloxy-6-[(E)-[5-methyl-1-(2-methylpropyl)-2-oxoindol-3-ylidene]amino]oxyoxan-2-yl]methyl acetate.
| Compound Name | [(2S,3S,4S,5R,6S)-5-acetamido-3,4-diacetyloxy-6-[(E)-[5-methyl-1-(2-methylpropyl)-2-oxoindol-3-ylidene]amino]oxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 98169612 |
| Molecular Formula | C27H35N3O10 |
| Molecular Weight | 561.59 g/mol |
| Exact Mass | 561.23 |
| IUPAC Name | [(2S,3S,4S,5R,6S)-5-acetamido-3,4-diacetyloxy-6-[(E)-[5-methyl-1-(2-methylpropyl)-2-oxoindol-3-ylidene]amino]oxyoxan-2-yl]methyl acetate |
| SMILES | CC(=O)N[C@H]1[C@H](O/N=C2/C(=O)N(CC(C)C)c3ccc(C)cc32)O[C@@H](COC(C)=O)[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C27H35N3O10/c1-13(2)11-30-20-9-8-14(3)10-19(20)22(26(30)35)29-40-27-23(28-15(4)31)25(38-18(7)34)24(37-17(6)33)21(39-27)12-36-16(5)32/h8-10,13,21,23-25,27H,11-12H2,1-7H3,(H,28,31)/b29-22+/t21-,23+,24+,25-,27-/m0/s1 |
| InChIKey | HICQIXWTNSAUJU-DZSRILGRSA-N |
| XLogP | 1.37 |
| TPSA | 159.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.59 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|