C23H27N3O10 — CID 124838629
[(2R,3R,4R,5S,6S)-5-acetamido-3,4-diacetyloxy-6-[(Z)-(1-methyl-2-oxoindol-3-ylidene)amino]oxyoxan-2-yl]methyl acetate (PubChem CID 124838629) has the molecular formula C23H27N3O10 and a molecular weight of 505.48 g/mol. Its IUPAC name is [(2R,3R,4R,5S,6S)-5-acetamido-3,4-diacetyloxy-6-[(Z)-(1-methyl-2-oxoindol-3-ylidene)amino]oxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5S,6S)-5-acetamido-3,4-diacetyloxy-6-[(Z)-(1-methyl-2-oxoindol-3-ylidene)amino]oxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 124838629 |
| Molecular Formula | C23H27N3O10 |
| Molecular Weight | 505.48 g/mol |
| Exact Mass | 505.17 |
| IUPAC Name | [(2R,3R,4R,5S,6S)-5-acetamido-3,4-diacetyloxy-6-[(Z)-(1-methyl-2-oxoindol-3-ylidene)amino]oxyoxan-2-yl]methyl acetate |
| SMILES | CC(=O)N[C@@H]1[C@H](O/N=C2\C(=O)N(C)c3ccccc32)O[C@H](COC(C)=O)[C@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C23H27N3O10/c1-11(27)24-19-21(34-14(4)30)20(33-13(3)29)17(10-32-12(2)28)35-23(19)36-25-18-15-8-6-7-9-16(15)26(5)22(18)31/h6-9,17,19-21,23H,10H2,1-5H3,(H,24,27)/b25-18-/t17-,19+,20+,21-,23+/m1/s1 |
| InChIKey | BBTZEMVLPXANPT-KGMUUXMDSA-N |
| XLogP | 0.04 |
| TPSA | 159.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.48 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|