C29H31N3O10 — CID 75507780
[(2R,3S,4R,5R,6S)-5-acetamido-3,4-diacetyloxy-6-[(E)-(1-benzyl-2-oxoindol-3-ylidene)amino]oxyoxan-2-yl]methyl acetate (PubChem CID 75507780) has the molecular formula C29H31N3O10 and a molecular weight of 581.58 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6S)-5-acetamido-3,4-diacetyloxy-6-[(E)-(1-benzyl-2-oxoindol-3-ylidene)amino]oxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5R,6S)-5-acetamido-3,4-diacetyloxy-6-[(E)-(1-benzyl-2-oxoindol-3-ylidene)amino]oxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 75507780 |
| Molecular Formula | C29H31N3O10 |
| Molecular Weight | 581.58 g/mol |
| Exact Mass | 581.20 |
| IUPAC Name | [(2R,3S,4R,5R,6S)-5-acetamido-3,4-diacetyloxy-6-[(E)-(1-benzyl-2-oxoindol-3-ylidene)amino]oxyoxan-2-yl]methyl acetate |
| SMILES | CC(=O)N[C@H]1[C@H](O/N=C2/C(=O)N(Cc3ccccc3)c3ccccc32)O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C29H31N3O10/c1-16(33)30-25-27(40-19(4)36)26(39-18(3)35)23(15-38-17(2)34)41-29(25)42-31-24-21-12-8-9-13-22(21)32(28(24)37)14-20-10-6-5-7-11-20/h5-13,23,25-27,29H,14-15H2,1-4H3,(H,30,33)/b31-24+/t23-,25-,26-,27-,29+/m1/s1 |
| InChIKey | LGJOIVKBEGHIQA-VUNHVOSISA-N |
| XLogP | 1.61 |
| TPSA | 159.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.58 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|