C30H33N3O10 — CID 124917272
[(2R,3R,4S,5S,6S)-5-acetamido-3,4-diacetyloxy-6-[(1-benzyl-5-methyl-2-oxoindol-3-ylidene)amino]oxyoxan-2-yl]methyl acetate (PubChem CID 124917272) has the molecular formula C30H33N3O10 and a molecular weight of 595.61 g/mol. Its IUPAC name is [(2R,3R,4S,5S,6S)-5-acetamido-3,4-diacetyloxy-6-[(1-benzyl-5-methyl-2-oxoindol-3-ylidene)amino]oxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5S,6S)-5-acetamido-3,4-diacetyloxy-6-[(1-benzyl-5-methyl-2-oxoindol-3-ylidene)amino]oxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 124917272 |
| Molecular Formula | C30H33N3O10 |
| Molecular Weight | 595.61 g/mol |
| Exact Mass | 595.22 |
| IUPAC Name | [(2R,3R,4S,5S,6S)-5-acetamido-3,4-diacetyloxy-6-[(1-benzyl-5-methyl-2-oxoindol-3-ylidene)amino]oxyoxan-2-yl]methyl acetate |
| SMILES | CC(=O)N[C@@H]1[C@H](ON=C2C(=O)N(Cc3ccccc3)c3ccc(C)cc32)O[C@H](COC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C30H33N3O10/c1-16-11-12-23-22(13-16)25(29(38)33(23)14-21-9-7-6-8-10-21)32-43-30-26(31-17(2)34)28(41-20(5)37)27(40-19(4)36)24(42-30)15-39-18(3)35/h6-13,24,26-28,30H,14-15H2,1-5H3,(H,31,34)/t24-,26+,27+,28+,30+/m1/s1 |
| InChIKey | DUIATCQAKMZOAD-IRSSOGQRSA-N |
| XLogP | 1.92 |
| TPSA | 159.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.61 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|