C13H14O2 — CID 98173681
(1'R,2R,2'R,7'S,8'R)-spiro[oxetane-2,6'-tricyclo[6.2.1.02,7]undeca-4,9-diene]-3'-one (PubChem CID 98173681) has the molecular formula C13H14O2 and a molecular weight of 202.25 g/mol. Its IUPAC name is (1'R,2R,2'R,7'S,8'R)-spiro[oxetane-2,6'-tricyclo[6.2.1.02,7]undeca-4,9-diene]-3'-one.
| Compound Name | (1'R,2R,2'R,7'S,8'R)-spiro[oxetane-2,6'-tricyclo[6.2.1.02,7]undeca-4,9-diene]-3'-one |
|---|---|
| PubChem CID | 98173681 |
| Molecular Formula | C13H14O2 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | (1'R,2R,2'R,7'S,8'R)-spiro[oxetane-2,6'-tricyclo[6.2.1.02,7]undeca-4,9-diene]-3'-one |
| SMILES | O=C1C=C[C@]2(CCO2)[C@@H]2[C@H]1[C@H]1C=C[C@H]2C1 |
| InChI | InChI=1S/C13H14O2/c14-10-3-4-13(5-6-15-13)12-9-2-1-8(7-9)11(10)12/h1-4,8-9,11-12H,5-7H2/t8-,9-,11-,12-,13-/m0/s1 |
| InChIKey | GZVHYPLQOGLCPN-PGCAYKIGSA-N |
| XLogP | 1.72 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|