C19H14Br2N4O4 — CID 98188981
(7R,11R)-7,11-bis(3-bromophenyl)-2,4,8,10-tetrazaspiro[5.5]undecane-1,3,5,9-tetrone (PubChem CID 98188981) has the molecular formula C19H14Br2N4O4 and a molecular weight of 522.15 g/mol. Its IUPAC name is (7R,11R)-7,11-bis(3-bromophenyl)-2,4,8,10-tetrazaspiro[5.5]undecane-1,3,5,9-tetrone.
| Compound Name | (7R,11R)-7,11-bis(3-bromophenyl)-2,4,8,10-tetrazaspiro[5.5]undecane-1,3,5,9-tetrone |
|---|---|
| PubChem CID | 98188981 |
| Molecular Formula | C19H14Br2N4O4 |
| Molecular Weight | 522.15 g/mol |
| Exact Mass | 519.94 |
| IUPAC Name | (7R,11R)-7,11-bis(3-bromophenyl)-2,4,8,10-tetrazaspiro[5.5]undecane-1,3,5,9-tetrone |
| SMILES | O=C1NC(=O)C2(C(=O)N1)[C@@H](c1cccc(Br)c1)NC(=O)N[C@@H]2c1cccc(Br)c1 |
| InChI | InChI=1S/C19H14Br2N4O4/c20-11-5-1-3-9(7-11)13-19(15(26)24-18(29)25-16(19)27)14(23-17(28)22-13)10-4-2-6-12(21)8-10/h1-8,13-14H,(H2,22,23,28)(H2,24,25,26,27,29)/t13-,14-/m1/s1 |
| InChIKey | LVDFAVXZLSJTDL-ZIAGYGMSSA-N |
| XLogP | 2.66 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.15 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|