C19H29N3O5S2 — CID 98191237
tert-butyl N-[2-[[(3aR,6aS)-3-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]amino]-2-oxoethyl]carbamate (PubChem CID 98191237) has the molecular formula C19H29N3O5S2 and a molecular weight of 443.59 g/mol. Its IUPAC name is tert-butyl N-[2-[[(3aR,6aS)-3-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]amino]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[(3aR,6aS)-3-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]amino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 98191237 |
| Molecular Formula | C19H29N3O5S2 |
| Molecular Weight | 443.59 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | tert-butyl N-[2-[[(3aR,6aS)-3-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]amino]-2-oxoethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(=O)/N=C1\S[C@@H]2CS(=O)(=O)C[C@H]2N1[C@@H]1C[C@@H]2CC[C@@H]1C2 |
| InChI | InChI=1S/C19H29N3O5S2/c1-19(2,3)27-18(24)20-8-16(23)21-17-22(13-7-11-4-5-12(13)6-11)14-9-29(25,26)10-15(14)28-17/h11-15H,4-10H2,1-3H3,(H,20,24)/b21-17-/t11-,12-,13-,14-,15-/m1/s1 |
| InChIKey | OBWCHMGPDSNYOV-WYWYMDJXSA-N |
| XLogP | 1.80 |
| TPSA | 105.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.59 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|