C33H38FN3O2S — CID 98207057
(2R)-N-[3-(4-benzylpiperidin-1-yl)propyl]-2-[(2S)-4-[(4-fluorophenyl)methyl]-3-oxo-1,4-benzothiazin-2-yl]propanamide (PubChem CID 98207057) has the molecular formula C33H38FN3O2S and a molecular weight of 559.75 g/mol. Its IUPAC name is (2R)-N-[3-(4-benzylpiperidin-1-yl)propyl]-2-[(2S)-4-[(4-fluorophenyl)methyl]-3-oxo-1,4-benzothiazin-2-yl]propanamide.
| Compound Name | (2R)-N-[3-(4-benzylpiperidin-1-yl)propyl]-2-[(2S)-4-[(4-fluorophenyl)methyl]-3-oxo-1,4-benzothiazin-2-yl]propanamide |
|---|---|
| PubChem CID | 98207057 |
| Molecular Formula | C33H38FN3O2S |
| Molecular Weight | 559.75 g/mol |
| Exact Mass | 559.27 |
| IUPAC Name | (2R)-N-[3-(4-benzylpiperidin-1-yl)propyl]-2-[(2S)-4-[(4-fluorophenyl)methyl]-3-oxo-1,4-benzothiazin-2-yl]propanamide |
| SMILES | C[C@H](C(=O)NCCCN1CCC(Cc2ccccc2)CC1)[C@@H]1Sc2ccccc2N(Cc2ccc(F)cc2)C1=O |
| InChI | InChI=1S/C33H38FN3O2S/c1-24(32(38)35-18-7-19-36-20-16-26(17-21-36)22-25-8-3-2-4-9-25)31-33(39)37(23-27-12-14-28(34)15-13-27)29-10-5-6-11-30(29)40-31/h2-6,8-15,24,26,31H,7,16-23H2,1H3,(H,35,38)/t24-,31-/m0/s1 |
| InChIKey | VCYRPWJEMIMZOW-DLLPINGYSA-N |
| XLogP | 5.93 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.75 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|