C19H21N3O2 — CID 98208111
(1R,2S,4S)-N-[1-[2-(methylamino)-2-oxoethyl]indol-6-yl]bicyclo[2.2.1]hept-5-ene-2-carboxamide (PubChem CID 98208111) has the molecular formula C19H21N3O2 and a molecular weight of 323.40 g/mol. Its IUPAC name is (1R,2S,4S)-N-[1-[2-(methylamino)-2-oxoethyl]indol-6-yl]bicyclo[2.2.1]hept-5-ene-2-carboxamide.
| Compound Name | (1R,2S,4S)-N-[1-[2-(methylamino)-2-oxoethyl]indol-6-yl]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
|---|---|
| PubChem CID | 98208111 |
| Molecular Formula | C19H21N3O2 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | (1R,2S,4S)-N-[1-[2-(methylamino)-2-oxoethyl]indol-6-yl]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
| SMILES | CNC(=O)Cn1ccc2ccc(NC(=O)[C@H]3C[C@H]4C=C[C@H]3C4)cc21 |
| InChI | InChI=1S/C19H21N3O2/c1-20-18(23)11-22-7-6-13-4-5-15(10-17(13)22)21-19(24)16-9-12-2-3-14(16)8-12/h2-7,10,12,14,16H,8-9,11H2,1H3,(H,20,23)(H,21,24)/t12-,14-,16-/m0/s1 |
| InChIKey | PXPZYHYTWKQAQW-NOLJZWGESA-N |
| XLogP | 2.54 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|