C28H26N6O3S — CID 98214086
(1R,9R,13S)-5,11-bis(furan-2-ylmethyl)-13-(2-methoxyphenyl)-8-sulfanylidene-3,5,7,11-tetrazatricyclo[7.3.1.02,7]tridec-2-ene-1,9-dicarbonitrile (PubChem CID 98214086) has the molecular formula C28H26N6O3S and a molecular weight of 526.62 g/mol. Its IUPAC name is (1R,9R,13S)-5,11-bis(furan-2-ylmethyl)-13-(2-methoxyphenyl)-8-sulfanylidene-3,5,7,11-tetrazatricyclo[7.3.1.02,7]tridec-2-ene-1,9-dicarbonitrile.
| Compound Name | (1R,9R,13S)-5,11-bis(furan-2-ylmethyl)-13-(2-methoxyphenyl)-8-sulfanylidene-3,5,7,11-tetrazatricyclo[7.3.1.02,7]tridec-2-ene-1,9-dicarbonitrile |
|---|---|
| PubChem CID | 98214086 |
| Molecular Formula | C28H26N6O3S |
| Molecular Weight | 526.62 g/mol |
| Exact Mass | 526.18 |
| IUPAC Name | (1R,9R,13S)-5,11-bis(furan-2-ylmethyl)-13-(2-methoxyphenyl)-8-sulfanylidene-3,5,7,11-tetrazatricyclo[7.3.1.02,7]tridec-2-ene-1,9-dicarbonitrile |
| SMILES | COc1ccccc1[C@H]1[C@]2(C#N)CN(Cc3ccco3)C[C@]1(C#N)C1=NCN(Cc3ccco3)CN1C2=S |
| InChI | InChI=1S/C28H26N6O3S/c1-35-23-9-3-2-8-22(23)24-27(14-29)16-32(12-20-6-4-10-36-20)17-28(24,15-30)26(38)34-19-33(18-31-25(27)34)13-21-7-5-11-37-21/h2-11,24H,12-13,16-19H2,1H3/t24-,27+,28+/m1/s1 |
| InChIKey | MCDIRFIZOXXFAR-KGPYPHOUSA-N |
| XLogP | 3.97 |
| TPSA | 105.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.62 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|