C17H20N2O3S2 — CID 23760892
3-[(3,4-dimethoxyphenyl)methyl]-5-(furan-2-ylmethyl)-1,3,5-thiadiazinane-2-thione (PubChem CID 23760892) has the molecular formula C17H20N2O3S2 and a molecular weight of 364.49 g/mol. Its IUPAC name is 3-[(3,4-dimethoxyphenyl)methyl]-5-(furan-2-ylmethyl)-1,3,5-thiadiazinane-2-thione.
| Compound Name | 3-[(3,4-dimethoxyphenyl)methyl]-5-(furan-2-ylmethyl)-1,3,5-thiadiazinane-2-thione |
|---|---|
| PubChem CID | 23760892 |
| Molecular Formula | C17H20N2O3S2 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.09 |
| IUPAC Name | 3-[(3,4-dimethoxyphenyl)methyl]-5-(furan-2-ylmethyl)-1,3,5-thiadiazinane-2-thione |
| SMILES | COc1ccc(CN2CN(Cc3ccco3)CSC2=S)cc1OC |
| InChI | InChI=1S/C17H20N2O3S2/c1-20-15-6-5-13(8-16(15)21-2)9-19-11-18(12-24-17(19)23)10-14-4-3-7-22-14/h3-8H,9-12H2,1-2H3 |
| InChIKey | ZJBNQXVEMKXJCW-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 38.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|