C12H18N2OS2 — CID 23848611
3-tert-butyl-5-(furan-2-ylmethyl)-1,3,5-thiadiazinane-2-thione (PubChem CID 23848611) has the molecular formula C12H18N2OS2 and a molecular weight of 270.42 g/mol. Its IUPAC name is 3-tert-butyl-5-(furan-2-ylmethyl)-1,3,5-thiadiazinane-2-thione.
| Compound Name | 3-tert-butyl-5-(furan-2-ylmethyl)-1,3,5-thiadiazinane-2-thione |
|---|---|
| PubChem CID | 23848611 |
| Molecular Formula | C12H18N2OS2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | 3-tert-butyl-5-(furan-2-ylmethyl)-1,3,5-thiadiazinane-2-thione |
| SMILES | CC(C)(C)N1CN(Cc2ccco2)CSC1=S |
| InChI | InChI=1S/C12H18N2OS2/c1-12(2,3)14-8-13(9-17-11(14)16)7-10-5-4-6-15-10/h4-6H,7-9H2,1-3H3 |
| InChIKey | KIDAYUBMOXLRDR-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 19.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|