C17H24N2O2S2 — CID 23960929
3-cyclopentyl-5-[(3,4-dimethoxyphenyl)methyl]-1,3,5-thiadiazinane-2-thione (PubChem CID 23960929) has the molecular formula C17H24N2O2S2 and a molecular weight of 352.53 g/mol. Its IUPAC name is 3-cyclopentyl-5-[(3,4-dimethoxyphenyl)methyl]-1,3,5-thiadiazinane-2-thione.
| Compound Name | 3-cyclopentyl-5-[(3,4-dimethoxyphenyl)methyl]-1,3,5-thiadiazinane-2-thione |
|---|---|
| PubChem CID | 23960929 |
| Molecular Formula | C17H24N2O2S2 |
| Molecular Weight | 352.53 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | 3-cyclopentyl-5-[(3,4-dimethoxyphenyl)methyl]-1,3,5-thiadiazinane-2-thione |
| SMILES | COc1ccc(CN2CSC(=S)N(C3CCCC3)C2)cc1OC |
| InChI | InChI=1S/C17H24N2O2S2/c1-20-15-8-7-13(9-16(15)21-2)10-18-11-19(17(22)23-12-18)14-5-3-4-6-14/h7-9,14H,3-6,10-12H2,1-2H3 |
| InChIKey | SBERCKJYAURPCF-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.53 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|