C20H22N6OSe — CID 44615743
13-(2-methoxyphenyl)-5,11-dimethyl-8-selanylidene-3,5,7,11-tetrazatricyclo[7.3.1.02,7]tridec-2-ene-1,9-dicarbonitrile (PubChem CID 44615743) has the molecular formula C20H22N6OSe and a molecular weight of 441.40 g/mol. Its IUPAC name is 13-(2-methoxyphenyl)-5,11-dimethyl-8-selanylidene-3,5,7,11-tetrazatricyclo[7.3.1.02,7]tridec-2-ene-1,9-dicarbonitrile.
| Compound Name | 13-(2-methoxyphenyl)-5,11-dimethyl-8-selanylidene-3,5,7,11-tetrazatricyclo[7.3.1.02,7]tridec-2-ene-1,9-dicarbonitrile |
|---|---|
| PubChem CID | 44615743 |
| Molecular Formula | C20H22N6OSe |
| Molecular Weight | 441.40 g/mol |
| Exact Mass | 442.10 |
| IUPAC Name | 13-(2-methoxyphenyl)-5,11-dimethyl-8-selanylidene-3,5,7,11-tetrazatricyclo[7.3.1.02,7]tridec-2-ene-1,9-dicarbonitrile |
| SMILES | COc1ccccc1C1C2(C#N)CN(C)CC1(C#N)C1=NCN(C)CN1C2=[Se] |
| InChI | InChI=1S/C20H22N6OSe/c1-24-10-19(8-21)16(14-6-4-5-7-15(14)27-3)20(9-22,11-24)18(28)26-13-25(2)12-23-17(19)26/h4-7,16H,10-13H2,1-3H3 |
| InChIKey | QAQGIFVSOUYWEI-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 78.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.40 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|