C30H24Cl2N6OS — CID 98451553
(1S,9S,13S)-5,11-bis(4-chlorophenyl)-13-(2-methoxyphenyl)-8-sulfanylidene-3,5,7,11-tetrazatricyclo[7.3.1.02,7]tridec-2-ene-1,9-dicarbonitrile (PubChem CID 98451553) has the molecular formula C30H24Cl2N6OS and a molecular weight of 587.54 g/mol. Its IUPAC name is (1S,9S,13S)-5,11-bis(4-chlorophenyl)-13-(2-methoxyphenyl)-8-sulfanylidene-3,5,7,11-tetrazatricyclo[7.3.1.02,7]tridec-2-ene-1,9-dicarbonitrile.
| Compound Name | (1S,9S,13S)-5,11-bis(4-chlorophenyl)-13-(2-methoxyphenyl)-8-sulfanylidene-3,5,7,11-tetrazatricyclo[7.3.1.02,7]tridec-2-ene-1,9-dicarbonitrile |
|---|---|
| PubChem CID | 98451553 |
| Molecular Formula | C30H24Cl2N6OS |
| Molecular Weight | 587.54 g/mol |
| Exact Mass | 586.11 |
| IUPAC Name | (1S,9S,13S)-5,11-bis(4-chlorophenyl)-13-(2-methoxyphenyl)-8-sulfanylidene-3,5,7,11-tetrazatricyclo[7.3.1.02,7]tridec-2-ene-1,9-dicarbonitrile |
| SMILES | COc1ccccc1[C@H]1[C@@]2(C#N)CN(c3ccc(Cl)cc3)C[C@@]1(C#N)C1=NCN(c3ccc(Cl)cc3)CN1C2=S |
| InChI | InChI=1S/C30H24Cl2N6OS/c1-39-25-5-3-2-4-24(25)26-29(14-33)16-36(22-10-6-20(31)7-11-22)17-30(26,15-34)28(40)38-19-37(18-35-27(29)38)23-12-8-21(32)9-13-23/h2-13,26H,16-19H2,1H3/t26-,29-,30-/m1/s1 |
| InChIKey | MFEAECZNRKUUOE-KXTWMDTESA-N |
| XLogP | 6.10 |
| TPSA | 78.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.54 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|