C22H26F3N3O3 — CID 98214979
(5R,7R)-3-acetamido-N-methyl-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]adamantane-1-carboxamide (PubChem CID 98214979) has the molecular formula C22H26F3N3O3 and a molecular weight of 437.46 g/mol. Its IUPAC name is (5R,7R)-3-acetamido-N-methyl-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]adamantane-1-carboxamide.
| Compound Name | (5R,7R)-3-acetamido-N-methyl-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 98214979 |
| Molecular Formula | C22H26F3N3O3 |
| Molecular Weight | 437.46 g/mol |
| Exact Mass | 437.19 |
| IUPAC Name | (5R,7R)-3-acetamido-N-methyl-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]adamantane-1-carboxamide |
| SMILES | CC(=O)NC12C[C@@H]3C[C@@H](C1)CC(C(=O)N(C)CC(=O)Nc1ccc(F)c(F)c1F)(C3)C2 |
| InChI | InChI=1S/C22H26F3N3O3/c1-12(29)27-22-8-13-5-14(9-22)7-21(6-13,11-22)20(31)28(2)10-17(30)26-16-4-3-15(23)18(24)19(16)25/h3-4,13-14H,5-11H2,1-2H3,(H,26,30)(H,27,29)/t13-,14-,21?,22?/m1/s1 |
| InChIKey | RDHYOQXDTGYMEA-CFYSCFQDSA-N |
| XLogP | 2.98 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.46 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|